C23H21FN6O3S — CID 130252516
3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(2H-pyrrol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 130252516) has the molecular formula C23H21FN6O3S and a molecular weight of 480.53 g/mol. Its IUPAC name is 3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(2H-pyrrol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(2H-pyrrol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 130252516 |
| Molecular Formula | C23H21FN6O3S |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(2H-pyrrol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4)s3)cn2N(C)C1C1=CCN=C1 |
| InChI | InChI=1S/C23H21FN6O3S/c1-3-29-22(14-8-9-25-11-14)28(2)30-12-16(19(31)20(32)18(30)23(29)33)21-27-26-17(34-21)10-13-4-6-15(24)7-5-13/h4-8,11-12,22,32H,3,9-10H2,1-2H3 |
| InChIKey | BQMYQEPTZTUPGO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |