C22H20FN7O3S — CID 90245057
3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(1H-pyrazol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 90245057) has the molecular formula C22H20FN7O3S and a molecular weight of 481.51 g/mol. Its IUPAC name is 3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(1H-pyrazol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(1H-pyrazol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 90245057 |
| Molecular Formula | C22H20FN7O3S |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-5-hydroxy-1-methyl-2-(1H-pyrazol-4-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4)s3)cn2N(C)C1c1cn[nH]c1 |
| InChI | InChI=1S/C22H20FN7O3S/c1-3-29-21(13-9-24-25-10-13)28(2)30-11-15(18(31)19(32)17(30)22(29)33)20-27-26-16(34-20)8-12-4-6-14(23)7-5-12/h4-7,9-11,21,32H,3,8H2,1-2H3,(H,24,25) |
| InChIKey | UELKLNASFMQKNA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |