C21H18ClFN4O3S — CID 130255403
6-[5-[(3-chloro-2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-2,5-dione (PubChem CID 130255403) has the molecular formula C21H18ClFN4O3S and a molecular weight of 460.92 g/mol. Its IUPAC name is 6-[5-[(3-chloro-2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-2,5-dione.
| Compound Name | 6-[5-[(3-chloro-2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-2,5-dione |
|---|---|
| PubChem CID | 130255403 |
| Molecular Formula | C21H18ClFN4O3S |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 6-[5-[(3-chloro-2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-2,5-dione |
| SMILES | O=C1c2c(O)c(=O)c(-c3nnc(Cc4cccc(Cl)c4F)s3)cn2CC2CCCCN12 |
| InChI | InChI=1S/C21H18ClFN4O3S/c22-14-6-3-4-11(16(14)23)8-15-24-25-20(31-15)13-10-26-9-12-5-1-2-7-27(12)21(30)17(26)19(29)18(13)28/h3-4,6,10,12,29H,1-2,5,7-9H2 |
| InChIKey | CDVVPDZSGOTSGI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |