C29H25F2N3O4S — CID 130255460
(3S,7R)-13-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 130255460) has the molecular formula C29H25F2N3O4S and a molecular weight of 549.60 g/mol. Its IUPAC name is (3S,7R)-13-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3S,7R)-13-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 130255460 |
| Molecular Formula | C29H25F2N3O4S |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | (3S,7R)-13-[2-[(2,4-difluorophenyl)methyl]-1,3-thiazol-5-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | C[C@@H]1CCO[C@H]2Cn3cc(-c4cnc(Cc5ccc(F)cc5F)s4)c(=O)c(OCc4ccccc4)c3C(=O)N12 |
| InChI | InChI=1S/C29H25F2N3O4S/c1-17-9-10-37-25-15-33-14-21(23-13-32-24(39-23)11-19-7-8-20(30)12-22(19)31)27(35)28(26(33)29(36)34(17)25)38-16-18-5-3-2-4-6-18/h2-8,12-14,17,25H,9-11,15-16H2,1H3/t17-,25+/m1/s1 |
| InChIKey | AJFSGBXVAGSPND-NSYGIPOTSA-N |
| XLogP | 5.01 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |