C28H25F2N5O4 — CID 130255581
(7R)-13-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 130255581) has the molecular formula C28H25F2N5O4 and a molecular weight of 533.54 g/mol. Its IUPAC name is (7R)-13-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (7R)-13-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 130255581 |
| Molecular Formula | C28H25F2N5O4 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (7R)-13-[5-[(2,4-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-7-methyl-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | C[C@@H]1CCOC2Cn3cc(-c4n[nH]c(Cc5ccc(F)cc5F)n4)c(=O)c(OCc4ccccc4)c3C(=O)N21 |
| InChI | InChI=1S/C28H25F2N5O4/c1-16-9-10-38-23-14-34-13-20(27-31-22(32-33-27)11-18-7-8-19(29)12-21(18)30)25(36)26(24(34)28(37)35(16)23)39-15-17-5-3-2-4-6-17/h2-8,12-13,16,23H,9-11,14-15H2,1H3,(H,31,32,33)/t16-,23?/m1/s1 |
| InChIKey | WYEGBOSSQJDFAU-ADRQNKRLSA-N |
| XLogP | 3.67 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |