C23H23ClFN3O — CID 13025583
4-[4-(7-chloroisoquinolin-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 13025583) has the molecular formula C23H23ClFN3O and a molecular weight of 411.91 g/mol. Its IUPAC name is 4-[4-(7-chloroisoquinolin-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[4-(7-chloroisoquinolin-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 13025583 |
| Molecular Formula | C23H23ClFN3O |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[4-(7-chloroisoquinolin-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCN1CCN(c2cc3ccc(Cl)cc3cn2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23ClFN3O/c24-20-6-3-18-15-23(26-16-19(18)14-20)28-12-10-27(11-13-28)9-1-2-22(29)17-4-7-21(25)8-5-17/h3-8,14-16H,1-2,9-13H2 |
| InChIKey | IZEXEKZNMALQEU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |