C10H18F3N2O3+ — CID 130266503
carboxymethyl-dimethyl-[3-[methyl-(2,2,2-trifluoroacetyl)amino]propyl]azanium (PubChem CID 130266503) has the molecular formula C10H18F3N2O3+ and a molecular weight of 271.26 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[methyl-(2,2,2-trifluoroacetyl)amino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[methyl-(2,2,2-trifluoroacetyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 130266503 |
| Molecular Formula | C10H18F3N2O3+ |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[methyl-(2,2,2-trifluoroacetyl)amino]propyl]azanium |
| SMILES | CN(CCC[N+](C)(C)CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-14(9(18)10(11,12)13)5-4-6-15(2,3)7-8(16)17/h4-7H2,1-3H3/p+1 |
| InChIKey | WQCIXPRGYBUUHV-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|