C11H18F6N3O3+ — CID 130266666
carboxymethyl-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl]-dimethylazanium (PubChem CID 130266666) has the molecular formula C11H18F6N3O3+ and a molecular weight of 354.27 g/mol. Its IUPAC name is carboxymethyl-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl]-dimethylazanium.
| Compound Name | carboxymethyl-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 130266666 |
| Molecular Formula | C11H18F6N3O3+ |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | carboxymethyl-[[[2-[dimethylamino(difluoro)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]methyl]-dimethylazanium |
| SMILES | CN(C)C(F)(F)C(F)(C(=O)NC[N+](C)(C)CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H17F6N3O3/c1-19(2)11(16,17)9(12,10(13,14)15)8(23)18-6-20(3,4)5-7(21)22/h5-6H2,1-4H3,(H-,18,21,22,23)/p+1 |
| InChIKey | RKMMHDOUWJYMCC-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|