C30H44N2 — CID 130267913
(2R)-2-(2-tert-butylphenyl)-4-[4-tert-butyl-3-[(2S)-piperidin-2-yl]phenyl]piperidine (PubChem CID 130267913) has the molecular formula C30H44N2 and a molecular weight of 432.70 g/mol. Its IUPAC name is (2R)-2-(2-tert-butylphenyl)-4-[4-tert-butyl-3-[(2S)-piperidin-2-yl]phenyl]piperidine.
| Compound Name | (2R)-2-(2-tert-butylphenyl)-4-[4-tert-butyl-3-[(2S)-piperidin-2-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 130267913 |
| Molecular Formula | C30H44N2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (2R)-2-(2-tert-butylphenyl)-4-[4-tert-butyl-3-[(2S)-piperidin-2-yl]phenyl]piperidine |
| SMILES | CC(C)(C)c1ccc(C2CCN[C@@H](c3ccccc3C(C)(C)C)C2)cc1[C@@H]1CCCCN1 |
| InChI | InChI=1S/C30H44N2/c1-29(2,3)25-12-8-7-11-23(25)28-20-22(16-18-32-28)21-14-15-26(30(4,5)6)24(19-21)27-13-9-10-17-31-27/h7-8,11-12,14-15,19,22,27-28,31-32H,9-10,13,16-18,20H2,1-6H3/t22?,27-,28+/m0/s1 |
| InChIKey | GQCRDYBEOLPVPK-LPRJAOSGSA-N |
| XLogP | 7.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |