C37H45NO10P+ — CID 130270232
3-benzamidopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium (PubChem CID 130270232) has the molecular formula C37H45NO10P+ and a molecular weight of 694.74 g/mol. Its IUPAC name is 3-benzamidopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium.
| Compound Name | 3-benzamidopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 130270232 |
| Molecular Formula | C37H45NO10P+ |
| Molecular Weight | 694.74 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 3-benzamidopropyl-tris(2,4,6-trimethoxyphenyl)phosphanium |
| SMILES | COc1cc(OC)c([P+](CCCNC(=O)c2ccccc2)(c2c(OC)cc(OC)cc2OC)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C37H44NO10P/c1-40-25-18-28(43-4)34(29(19-25)44-5)49(17-13-16-38-37(39)24-14-11-10-12-15-24,35-30(45-6)20-26(41-2)21-31(35)46-7)36-32(47-8)22-27(42-3)23-33(36)48-9/h10-12,14-15,18-23H,13,16-17H2,1-9H3/p+1 |
| InChIKey | KMNWOPNLLRGABB-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.74 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|