C17H17NO3 — CID 13027784
[(3S,5R)-2,3-diphenyl-1,2-oxazolidin-5-yl] acetate (PubChem CID 13027784) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is [(3S,5R)-2,3-diphenyl-1,2-oxazolidin-5-yl] acetate.
| Compound Name | [(3S,5R)-2,3-diphenyl-1,2-oxazolidin-5-yl] acetate |
|---|---|
| PubChem CID | 13027784 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [(3S,5R)-2,3-diphenyl-1,2-oxazolidin-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](c2ccccc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C17H17NO3/c1-13(19)20-17-12-16(14-8-4-2-5-9-14)18(21-17)15-10-6-3-7-11-15/h2-11,16-17H,12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | NFCRCWGPKGNBJN-DLBZAZTESA-N |
| XLogP | 3.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |