C25H28FN3O3S — CID 130278906
4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(8-fluorooctyl)pyrrolo[3,2-b]pyridin-3-yl]thiophene-2-carboxylic acid (PubChem CID 130278906) has the molecular formula C25H28FN3O3S and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(8-fluorooctyl)pyrrolo[3,2-b]pyridin-3-yl]thiophene-2-carboxylic acid.
| Compound Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(8-fluorooctyl)pyrrolo[3,2-b]pyridin-3-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 130278906 |
| Molecular Formula | C25H28FN3O3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(8-fluorooctyl)pyrrolo[3,2-b]pyridin-3-yl]thiophene-2-carboxylic acid |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3csc(C(=O)O)c3)cn(CCCCCCCCF)c2c1 |
| InChI | InChI=1S/C25H28FN3O3S/c1-16-23(17(2)32-28-16)18-11-21-24(27-13-18)20(19-12-22(25(30)31)33-15-19)14-29(21)10-8-6-4-3-5-7-9-26/h11-15H,3-10H2,1-2H3,(H,30,31) |
| InChIKey | JQZZWONMMMGVLA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|