C13H16BrNO3S — CID 13027906
N-(4-bromophenyl)sulfonyl-1-methylcyclopentane-1-carboxamide (PubChem CID 13027906) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-1-methylcyclopentane-1-carboxamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-1-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 13027906 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-1-methylcyclopentane-1-carboxamide |
| SMILES | CC1(C(=O)NS(=O)(=O)c2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C13H16BrNO3S/c1-13(8-2-3-9-13)12(16)15-19(17,18)11-6-4-10(14)5-7-11/h4-7H,2-3,8-9H2,1H3,(H,15,16) |
| InChIKey | NYJMYAJGYFANAQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |