C17H14BrFN2O5S — CID 112844255
1-(4-bromophenyl)-N-(3-fluoro-5-nitrophenyl)sulfonylcyclobutane-1-carboxamide (PubChem CID 112844255) has the molecular formula C17H14BrFN2O5S and a molecular weight of 457.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(3-fluoro-5-nitrophenyl)sulfonylcyclobutane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-(3-fluoro-5-nitrophenyl)sulfonylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 112844255 |
| Molecular Formula | C17H14BrFN2O5S |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 1-(4-bromophenyl)-N-(3-fluoro-5-nitrophenyl)sulfonylcyclobutane-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cc(F)cc([N+](=O)[O-])c1)C1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C17H14BrFN2O5S/c18-12-4-2-11(3-5-12)17(6-1-7-17)16(22)20-27(25,26)15-9-13(19)8-14(10-15)21(23)24/h2-5,8-10H,1,6-7H2,(H,20,22) |
| InChIKey | AVJJZPJFYOIADK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|