About N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine
N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine (PubChem CID 130279098) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine.
Molecular Properties
| Compound Name | N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine |
| PubChem CID | 130279098 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine |
| SMILES | C=C(C)/C(C)=N/C(=C(C)C)C(C)C |
| InChI | InChI=1S/C12H21N/c1-8(2)11(7)13-12(9(3)4)10(5)6/h9H,1H2,2-7H3/b13-11+ |
| InChIKey | IIMHZNWJXKBVBJ-ACCUITESSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine?
The IUPAC name of N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine (CID 130279098) is N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine.
What is the SMILES notation for N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine?
The canonical SMILES for N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine is C=C(C)/C(C)=N/C(=C(C)C)C(C)C.
What is the InChIKey of N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine?
The InChIKey is IIMHZNWJXKBVBJ-ACCUITESSA-N. The full InChI is InChI=1S/C12H21N/c1-8(2)11(7)13-12(9(3)4)10(5)6/h9H,1H2,2-7H3/b13-11+.
What are the key properties of N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine?
N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine has a molecular weight of 179.31 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethylpent-2-en-3-yl)-3-methylbut-3-en-2-imine is sourced from PubChem (CID 130279098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).