C28H32Cl3NO10 — CID 130282097
3-chloropropyl (4R,7aR)-4a,9-bis(3-chloropropoxycarbonyloxy)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate (PubChem CID 130282097) has the molecular formula C28H32Cl3NO10 and a molecular weight of 648.92 g/mol. Its IUPAC name is 3-chloropropyl (4R,7aR)-4a,9-bis(3-chloropropoxycarbonyloxy)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate.
| Compound Name | 3-chloropropyl (4R,7aR)-4a,9-bis(3-chloropropoxycarbonyloxy)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 130282097 |
| Molecular Formula | C28H32Cl3NO10 |
| Molecular Weight | 648.92 g/mol |
| Exact Mass | 647.11 |
| IUPAC Name | 3-chloropropyl (4R,7aR)-4a,9-bis(3-chloropropoxycarbonyloxy)-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
| SMILES | O=C(OCCCCl)Oc1ccc2c3c1O[C@H]1C(=O)CCC4(OC(=O)OCCCCl)[C@@H](C2)N(C(=O)OCCCCl)CCC314 |
| InChI | InChI=1S/C28H32Cl3NO10/c29-9-1-13-37-24(34)32-12-8-27-21-17-4-5-19(40-25(35)38-14-2-10-30)22(21)41-23(27)18(33)6-7-28(27,20(32)16-17)42-26(36)39-15-3-11-31/h4-5,20,23H,1-3,6-16H2/t20-,23+,27?,28?/m1/s1 |
| InChIKey | JDYGXPGOYZLIGY-WOGIWZGUSA-N |
| XLogP | 5.11 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|