C30H35NO6 — CID 58206279
(4-amino-10-hydroxy-14-oxo-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-17-yl) 6-phenylhexyl carbonate (PubChem CID 58206279) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is (4-amino-10-hydroxy-14-oxo-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-17-yl) 6-phenylhexyl carbonate.
| Compound Name | (4-amino-10-hydroxy-14-oxo-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-17-yl) 6-phenylhexyl carbonate |
|---|---|
| PubChem CID | 58206279 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (4-amino-10-hydroxy-14-oxo-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-17-yl) 6-phenylhexyl carbonate |
| SMILES | NC1CCC23c4c5ccc(O)c4OC2C(=O)CCC3(OC(=O)OCCCCCCc2ccccc2)C1C5 |
| InChI | InChI=1S/C30H35NO6/c31-22-13-15-29-25-20-11-12-23(32)26(25)36-27(29)24(33)14-16-30(29,21(22)18-20)37-28(34)35-17-7-2-1-4-8-19-9-5-3-6-10-19/h3,5-6,9-12,21-22,27,32H,1-2,4,7-8,13-18,31H2 |
| InChIKey | SFGCKFDMJDGIEC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|