C26H25NO8 — CID 130281942
cyclopropen-1-ylmethyl (4R,7aR)-9-(cyclopropen-1-ylmethoxycarbonyloxy)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate (PubChem CID 130281942) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is cyclopropen-1-ylmethyl (4R,7aR)-9-(cyclopropen-1-ylmethoxycarbonyloxy)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate.
| Compound Name | cyclopropen-1-ylmethyl (4R,7aR)-9-(cyclopropen-1-ylmethoxycarbonyloxy)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 130281942 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | cyclopropen-1-ylmethyl (4R,7aR)-9-(cyclopropen-1-ylmethoxycarbonyloxy)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
| SMILES | O=C(OCC1=CC1)Oc1ccc2c3c1O[C@H]1C(=O)CCC4(O)[C@@H](C2)N(C(=O)OCC2=CC2)CCC314 |
| InChI | InChI=1S/C26H25NO8/c28-17-7-8-26(31)19-11-16-5-6-18(34-24(30)33-13-15-3-4-15)21-20(16)25(26,22(17)35-21)9-10-27(19)23(29)32-12-14-1-2-14/h1,3,5-6,19,22,31H,2,4,7-13H2/t19-,22+,25?,26?/m1/s1 |
| InChIKey | DMWPUDDNTTYIGH-YPXPGUQNSA-N |
| XLogP | 2.72 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|