C20H34N2O — CID 130284950
(1E,3E,9E)-7-(butylamino)-8,8-diethyl-4-methylcyclodeca-1,3,9-triene-1-carboxamide (PubChem CID 130284950) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is (1E,3E,9E)-7-(butylamino)-8,8-diethyl-4-methylcyclodeca-1,3,9-triene-1-carboxamide.
| Compound Name | (1E,3E,9E)-7-(butylamino)-8,8-diethyl-4-methylcyclodeca-1,3,9-triene-1-carboxamide |
|---|---|
| PubChem CID | 130284950 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (1E,3E,9E)-7-(butylamino)-8,8-diethyl-4-methylcyclodeca-1,3,9-triene-1-carboxamide |
| SMILES | CCCCNC1CC/C(C)=C/C=C(C(N)=O)\C=C\C1(CC)CC |
| InChI | InChI=1S/C20H34N2O/c1-5-8-15-22-18-12-10-16(4)9-11-17(19(21)23)13-14-20(18,6-2)7-3/h9,11,13-14,18,22H,5-8,10,12,15H2,1-4H3,(H2,21,23)/b14-13+,16-9+,17-11+ |
| InChIKey | WELBTYAIKWJVNU-XASLPKRTSA-N |
| XLogP | 4.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|