C17H20FN5O2 — CID 130285610
3-(4-fluoroanilino)-1-[(1S,4R)-4-hydroxy-2-methyliminocyclohexyl]pyrazole-4-carboxamide (PubChem CID 130285610) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-(4-fluoroanilino)-1-[(1S,4R)-4-hydroxy-2-methyliminocyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-fluoroanilino)-1-[(1S,4R)-4-hydroxy-2-methyliminocyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 130285610 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-(4-fluoroanilino)-1-[(1S,4R)-4-hydroxy-2-methyliminocyclohexyl]pyrazole-4-carboxamide |
| SMILES | C/N=C1\C[C@H](O)CC[C@@H]1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H20FN5O2/c1-20-14-8-12(24)6-7-15(14)23-9-13(16(19)25)17(22-23)21-11-4-2-10(18)3-5-11/h2-5,9,12,15,24H,6-8H2,1H3,(H2,19,25)(H,21,22)/b20-14+/t12-,15+/m1/s1 |
| InChIKey | BVISCXOFQQTWED-FBMUZZANSA-N |
| XLogP | 2.02 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|