C9H6F4NO2+ — CID 130287941
[2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium (PubChem CID 130287941) has the molecular formula C9H6F4NO2+ and a molecular weight of 236.14 g/mol. Its IUPAC name is [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium.
| Compound Name | [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 130287941 |
| Molecular Formula | C9H6F4NO2+ |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cc(C(=O)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H6F4NO2/c1-14(16)7-4-5(2-3-6(7)10)8(15)9(11,12)13/h2-4H,1H3/q+1 |
| InChIKey | UBNQFRJGTDLTAE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|