About [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium
[2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium (PubChem CID 130287941) has the molecular formula C9H6F4NO2+
and a molecular weight of 236.14 g/mol. Its IUPAC name is [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium.
Molecular Properties
| Compound Name | [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium |
| PubChem CID | 130287941 |
| Molecular Formula | C9H6F4NO2+ |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cc(C(=O)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H6F4NO2/c1-14(16)7-4-5(2-3-6(7)10)8(15)9(11,12)13/h2-4H,1H3/q+1 |
| InChIKey | UBNQFRJGTDLTAE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium?
The IUPAC name of [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium (CID 130287941) is [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium.
What is the SMILES notation for [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium?
The canonical SMILES for [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium is C[N+](=O)c1cc(C(=O)C(F)(F)F)ccc1F.
What is the InChIKey of [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium?
The InChIKey is UBNQFRJGTDLTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4NO2/c1-14(16)7-4-5(2-3-6(7)10)8(15)9(11,12)13/h2-4H,1H3/q+1.
What are the key properties of [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium?
[2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium has a molecular weight of 236.14 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-5-(2,2,2-trifluoroacetyl)phenyl]-methyl-oxoazanium is sourced from PubChem (CID 130287941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).