C27H16N2O3 — CID 130291727
7,18-dimethyl-19-methylidene-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17-trione (PubChem CID 130291727) has the molecular formula C27H16N2O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 7,18-dimethyl-19-methylidene-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17-trione.
| Compound Name | 7,18-dimethyl-19-methylidene-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17-trione |
|---|---|
| PubChem CID | 130291727 |
| Molecular Formula | C27H16N2O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 7,18-dimethyl-19-methylidene-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17-trione |
| SMILES | C=c1c2ccc3c4ccc5c6c(ccc(c7ccc(c(=O)n1C)c2c37)c64)C(=O)N(C)C5=O |
| InChI | InChI=1S/C27H16N2O3/c1-12-13-4-5-14-16-7-10-19-24-20(27(32)29(3)26(19)31)11-8-17(23(16)24)15-6-9-18(21(13)22(14)15)25(30)28(12)2/h4-11H,1H2,2-3H3 |
| InChIKey | MTBOZVCIYUZURK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|