C22H35NO3 — CID 130293506
4-(6-octoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)butanoic acid (PubChem CID 130293506) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 4-(6-octoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)butanoic acid.
| Compound Name | 4-(6-octoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 130293506 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 4-(6-octoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)butanoic acid |
| SMILES | CCCCCCCCOc1cccc2c1CCN(CCCC(=O)O)CC2 |
| InChI | InChI=1S/C22H35NO3/c1-2-3-4-5-6-7-18-26-21-11-8-10-19-13-16-23(17-14-20(19)21)15-9-12-22(24)25/h8,10-11H,2-7,9,12-18H2,1H3,(H,24,25) |
| InChIKey | ZCWJKXURMYQDAC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|