C22H33NO3 — CID 130293507
1-(8-octoxy-1,2,3,4-tetrahydronaphthalen-2-yl)azetidine-3-carboxylic acid (PubChem CID 130293507) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-(8-octoxy-1,2,3,4-tetrahydronaphthalen-2-yl)azetidine-3-carboxylic acid.
| Compound Name | 1-(8-octoxy-1,2,3,4-tetrahydronaphthalen-2-yl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130293507 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-(8-octoxy-1,2,3,4-tetrahydronaphthalen-2-yl)azetidine-3-carboxylic acid |
| SMILES | CCCCCCCCOc1cccc2c1CC(N1CC(C(=O)O)C1)CC2 |
| InChI | InChI=1S/C22H33NO3/c1-2-3-4-5-6-7-13-26-21-10-8-9-17-11-12-19(14-20(17)21)23-15-18(16-23)22(24)25/h8-10,18-19H,2-7,11-16H2,1H3,(H,24,25) |
| InChIKey | KGHJTTFEBRHULM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|