C20H24N2O3S — CID 135390134
1-[8-[3-(1,2-thiazol-4-yl)propoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]azetidine-3-carboxylic acid (PubChem CID 135390134) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[8-[3-(1,2-thiazol-4-yl)propoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]azetidine-3-carboxylic acid.
| Compound Name | 1-[8-[3-(1,2-thiazol-4-yl)propoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135390134 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[8-[3-(1,2-thiazol-4-yl)propoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C2CCc3cccc(OCCCc4cnsc4)c3C2)C1 |
| InChI | InChI=1S/C20H24N2O3S/c23-20(24)16-11-22(12-16)17-7-6-15-4-1-5-19(18(15)9-17)25-8-2-3-14-10-21-26-13-14/h1,4-5,10,13,16-17H,2-3,6-9,11-12H2,(H,23,24) |
| InChIKey | FBZSIZGMCVJJPS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|