C24H21N5O5 — CID 130298945
[6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] ethyl carbonate (PubChem CID 130298945) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is [6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] ethyl carbonate.
| Compound Name | [6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] ethyl carbonate |
|---|---|
| PubChem CID | 130298945 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1nc2c(C#N)nc(-c3ccc(OCC)cc3)nc2n1-c1ccccc1OC |
| InChI | InChI=1S/C24H21N5O5/c1-4-32-16-12-10-15(11-13-16)21-26-17(14-25)20-22(28-21)29(18-8-6-7-9-19(18)31-3)23(27-20)34-24(30)33-5-2/h6-13H,4-5H2,1-3H3 |
| InChIKey | YQMLDKGRIWAHMS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |