C40H44N8O4 — CID 177376043
N-[7-[bis(pyridin-2-ylmethyl)amino]heptyl]-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 177376043) has the molecular formula C40H44N8O4 and a molecular weight of 700.84 g/mol. Its IUPAC name is N-[7-[bis(pyridin-2-ylmethyl)amino]heptyl]-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | N-[7-[bis(pyridin-2-ylmethyl)amino]heptyl]-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 177376043 |
| Molecular Formula | C40H44N8O4 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | N-[7-[bis(pyridin-2-ylmethyl)amino]heptyl]-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NCCCCCCCN(Cc3ccccn3)Cc3ccccn3)c3[nH]c(=O)n(-c4ccccc4OC)c3n2)cc1 |
| InChI | InChI=1S/C40H44N8O4/c1-3-52-32-21-19-29(20-22-32)37-44-36(35-38(46-37)48(40(50)45-35)33-17-7-8-18-34(33)51-2)39(49)43-25-11-5-4-6-14-26-47(27-30-15-9-12-23-41-30)28-31-16-10-13-24-42-31/h7-10,12-13,15-24H,3-6,11,14,25-28H2,1-2H3,(H,43,49)(H,45,50) |
| InChIKey | GJHMOKWGGDHYOP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|