C21H20N6O4 — CID 150552575
methyl 4-[6-(aminomethylamino)-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]benzoate (PubChem CID 150552575) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is methyl 4-[6-(aminomethylamino)-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]benzoate.
| Compound Name | methyl 4-[6-(aminomethylamino)-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]benzoate |
|---|---|
| PubChem CID | 150552575 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 4-[6-(aminomethylamino)-9-(2-methoxyphenyl)-8-oxo-7H-purin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(NCN)c3[nH]c(=O)n(-c4ccccc4OC)c3n2)cc1 |
| InChI | InChI=1S/C21H20N6O4/c1-30-15-6-4-3-5-14(15)27-19-16(24-21(27)29)18(23-11-22)25-17(26-19)12-7-9-13(10-8-12)20(28)31-2/h3-10H,11,22H2,1-2H3,(H,24,29)(H,23,25,26) |
| InChIKey | IIEMQXGXAFZQIH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|