C26H26N6O4 — CID 130339996
tert-butyl N-[6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl]carbamate (PubChem CID 130339996) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is tert-butyl N-[6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl]carbamate.
| Compound Name | tert-butyl N-[6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl]carbamate |
|---|---|
| PubChem CID | 130339996 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | tert-butyl N-[6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl]carbamate |
| SMILES | CCOc1ccc(-c2nc(C#N)c3nc(NC(=O)OC(C)(C)C)n(-c4ccccc4OC)c3n2)cc1 |
| InChI | InChI=1S/C26H26N6O4/c1-6-35-17-13-11-16(12-14-17)22-28-18(15-27)21-23(30-22)32(19-9-7-8-10-20(19)34-5)24(29-21)31-25(33)36-26(2,3)4/h7-14H,6H2,1-5H3,(H,29,31,33) |
| InChIKey | ICEWYBYSRBULTM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |