C28H21N5O5 — CID 130298893
[6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] phenyl carbonate (PubChem CID 130298893) has the molecular formula C28H21N5O5 and a molecular weight of 507.51 g/mol. Its IUPAC name is [6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] phenyl carbonate.
| Compound Name | [6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] phenyl carbonate |
|---|---|
| PubChem CID | 130298893 |
| Molecular Formula | C28H21N5O5 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | [6-cyano-2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)purin-8-yl] phenyl carbonate |
| SMILES | CCOc1ccc(-c2nc(C#N)c3nc(OC(=O)Oc4ccccc4)n(-c4ccccc4OC)c3n2)cc1 |
| InChI | InChI=1S/C28H21N5O5/c1-3-36-19-15-13-18(14-16-19)25-30-21(17-29)24-26(32-25)33(22-11-7-8-12-23(22)35-2)27(31-24)38-28(34)37-20-9-5-4-6-10-20/h4-16H,3H2,1-2H3 |
| InChIKey | YYSWGPAYHLOGPQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|