C8H19N5O2 — CID 130301075
2-(1,4-diaminobutan-2-ylamino)butanediamide (PubChem CID 130301075) has the molecular formula C8H19N5O2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(1,4-diaminobutan-2-ylamino)butanediamide.
| Compound Name | 2-(1,4-diaminobutan-2-ylamino)butanediamide |
|---|---|
| PubChem CID | 130301075 |
| Molecular Formula | C8H19N5O2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(1,4-diaminobutan-2-ylamino)butanediamide |
| SMILES | NCCC(CN)NC(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C8H19N5O2/c9-2-1-5(4-10)13-6(8(12)15)3-7(11)14/h5-6,13H,1-4,9-10H2,(H2,11,14)(H2,12,15) |
| InChIKey | MLDIQCQPAAEYBX-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |