C6H9N3O2 — CID 88775772
2-(ethynylamino)butanediamide (PubChem CID 88775772) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 2-(ethynylamino)butanediamide.
| Compound Name | 2-(ethynylamino)butanediamide |
|---|---|
| PubChem CID | 88775772 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-(ethynylamino)butanediamide |
| SMILES | C#CNC(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C6H9N3O2/c1-2-9-4(6(8)11)3-5(7)10/h1,4,9H,3H2,(H2,7,10)(H2,8,11) |
| InChIKey | YOJBUSZKNIKKAP-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|