C25H19Cl3N2O4 — CID 130306988
(E)-3-[3-methyl-1-[5-propan-2-yl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid (PubChem CID 130306988) has the molecular formula C25H19Cl3N2O4 and a molecular weight of 517.80 g/mol. Its IUPAC name is (E)-3-[3-methyl-1-[5-propan-2-yl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methyl-1-[5-propan-2-yl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130306988 |
| Molecular Formula | C25H19Cl3N2O4 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | (E)-3-[3-methyl-1-[5-propan-2-yl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
| SMILES | Cc1cn(C(=O)c2c(-c3c(Cl)cc(Cl)cc3Cl)noc2C(C)C)c2cccc(/C=C/C(=O)O)c12 |
| InChI | InChI=1S/C25H19Cl3N2O4/c1-12(2)24-22(23(29-34-24)21-16(27)9-15(26)10-17(21)28)25(33)30-11-13(3)20-14(7-8-19(31)32)5-4-6-18(20)30/h4-12H,1-3H3,(H,31,32)/b8-7+ |
| InChIKey | MNHSYSZAEPPKAS-BQYQJAHWSA-N |
| XLogP | 7.47 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|