C26H22Cl2N2O4 — CID 130307328
(E)-3-[1-[5-tert-butyl-3-(2,6-dichloro-4-methylphenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid (PubChem CID 130307328) has the molecular formula C26H22Cl2N2O4 and a molecular weight of 497.38 g/mol. Its IUPAC name is (E)-3-[1-[5-tert-butyl-3-(2,6-dichloro-4-methylphenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[5-tert-butyl-3-(2,6-dichloro-4-methylphenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130307328 |
| Molecular Formula | C26H22Cl2N2O4 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (E)-3-[1-[5-tert-butyl-3-(2,6-dichloro-4-methylphenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
| SMILES | Cc1cc(Cl)c(-c2noc(C(C)(C)C)c2C(=O)n2ccc3c(/C=C/C(=O)O)cccc32)c(Cl)c1 |
| InChI | InChI=1S/C26H22Cl2N2O4/c1-14-12-17(27)21(18(28)13-14)23-22(24(34-29-23)26(2,3)4)25(33)30-11-10-16-15(8-9-20(31)32)6-5-7-19(16)30/h5-13H,1-4H3,(H,31,32)/b9-8+ |
| InChIKey | POCJZMUEOXWJNG-CMDGGOBGSA-N |
| XLogP | 7.00 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|