C24H18Cl2F2N2O4 — CID 130307143
(E)-3-[1-[3-(4,6-dichloro-2-fluorocyclohexa-1,3-dien-1-yl)-5-(2-fluoropropan-2-yl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid (PubChem CID 130307143) has the molecular formula C24H18Cl2F2N2O4 and a molecular weight of 507.32 g/mol. Its IUPAC name is (E)-3-[1-[3-(4,6-dichloro-2-fluorocyclohexa-1,3-dien-1-yl)-5-(2-fluoropropan-2-yl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[3-(4,6-dichloro-2-fluorocyclohexa-1,3-dien-1-yl)-5-(2-fluoropropan-2-yl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130307143 |
| Molecular Formula | C24H18Cl2F2N2O4 |
| Molecular Weight | 507.32 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | (E)-3-[1-[3-(4,6-dichloro-2-fluorocyclohexa-1,3-dien-1-yl)-5-(2-fluoropropan-2-yl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
| SMILES | CC(C)(F)c1onc(C2=C(F)C=C(Cl)CC2Cl)c1C(=O)n1ccc2c(/C=C/C(=O)O)cccc21 |
| InChI | InChI=1S/C24H18Cl2F2N2O4/c1-24(2,28)22-20(21(29-34-22)19-15(26)10-13(25)11-16(19)27)23(33)30-9-8-14-12(6-7-18(31)32)4-3-5-17(14)30/h3-9,11,15H,10H2,1-2H3,(H,31,32)/b7-6+ |
| InChIKey | ZWOHSKVZMNVLPB-VOTSOKGWSA-N |
| XLogP | 6.43 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.32 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|