C25H21Cl3N2O4 — CID 130307057
(E)-3-[1-[5-tert-butyl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]-2,3-dihydroindol-4-yl]prop-2-enoic acid (PubChem CID 130307057) has the molecular formula C25H21Cl3N2O4 and a molecular weight of 519.81 g/mol. Its IUPAC name is (E)-3-[1-[5-tert-butyl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]-2,3-dihydroindol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[5-tert-butyl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]-2,3-dihydroindol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130307057 |
| Molecular Formula | C25H21Cl3N2O4 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | (E)-3-[1-[5-tert-butyl-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]-2,3-dihydroindol-4-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1onc(-c2c(Cl)cc(Cl)cc2Cl)c1C(=O)N1CCc2c(/C=C/C(=O)O)cccc21 |
| InChI | InChI=1S/C25H21Cl3N2O4/c1-25(2,3)23-21(22(29-34-23)20-16(27)11-14(26)12-17(20)28)24(33)30-10-9-15-13(7-8-19(31)32)5-4-6-18(15)30/h4-8,11-12H,9-10H2,1-3H3,(H,31,32)/b8-7+ |
| InChIKey | DHOYKWMMIZQDPN-BQYQJAHWSA-N |
| XLogP | 6.90 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|