C28H20Cl3N3O3 — CID 154632045
(E)-3-[1-[2-(1-cyanocyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]-3-methylindol-4-yl]prop-2-enoic acid (PubChem CID 154632045) has the molecular formula C28H20Cl3N3O3 and a molecular weight of 552.85 g/mol. Its IUPAC name is (E)-3-[1-[2-(1-cyanocyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]-3-methylindol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[2-(1-cyanocyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]-3-methylindol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154632045 |
| Molecular Formula | C28H20Cl3N3O3 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | (E)-3-[1-[2-(1-cyanocyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]-3-methylindol-4-yl]prop-2-enoic acid |
| SMILES | Cc1cn(C(=O)c2c(-c3c(Cl)cc(Cl)cc3Cl)c[nH]c2C2(C#N)CCC2)c2cccc(/C=C/C(=O)O)c12 |
| InChI | InChI=1S/C28H20Cl3N3O3/c1-15-13-34(21-5-2-4-16(23(15)21)6-7-22(35)36)27(37)25-18(24-19(30)10-17(29)11-20(24)31)12-33-26(25)28(14-32)8-3-9-28/h2,4-7,10-13,33H,3,8-9H2,1H3,(H,35,36)/b7-6+ |
| InChIKey | OVPDXWSDOBPHTA-VOTSOKGWSA-N |
| XLogP | 7.64 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|