C19H18BrN3S3 — CID 130317966
7-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-hexylthiadiazolo[5,4-c]pyridine (PubChem CID 130317966) has the molecular formula C19H18BrN3S3 and a molecular weight of 464.48 g/mol. Its IUPAC name is 7-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-hexylthiadiazolo[5,4-c]pyridine.
| Compound Name | 7-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-hexylthiadiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 130317966 |
| Molecular Formula | C19H18BrN3S3 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | 7-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-hexylthiadiazolo[5,4-c]pyridine |
| SMILES | CCCCCCc1ncc(-c2ccc(-c3ccc(Br)s3)s2)c2nnsc12 |
| InChI | InChI=1S/C19H18BrN3S3/c1-2-3-4-5-6-13-19-18(22-23-26-19)12(11-21-13)14-7-8-15(24-14)16-9-10-17(20)25-16/h7-11H,2-6H2,1H3 |
| InChIKey | OJBIVTQYZYNABW-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|