C15H10FN3S3 — CID 130317913
6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine (PubChem CID 130317913) has the molecular formula C15H10FN3S3 and a molecular weight of 347.47 g/mol. Its IUPAC name is 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine.
| Compound Name | 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 130317913 |
| Molecular Formula | C15H10FN3S3 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine |
| SMILES | Cc1ccc(-c2c(F)nc(-c3ccc(C)s3)c3snnc23)s1 |
| InChI | InChI=1S/C15H10FN3S3/c1-7-3-5-9(20-7)11-13-14(22-19-18-13)12(17-15(11)16)10-6-4-8(2)21-10/h3-6H,1-2H3 |
| InChIKey | XMPCJOALJHAEMM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|