About 2,4-dimethylpyrrolo[3,4-b]indol-1-amine
2,4-dimethylpyrrolo[3,4-b]indol-1-amine (PubChem CID 130322165) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is 2,4-dimethylpyrrolo[3,4-b]indol-1-amine.
Molecular Properties
| Compound Name | 2,4-dimethylpyrrolo[3,4-b]indol-1-amine |
| PubChem CID | 130322165 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2,4-dimethylpyrrolo[3,4-b]indol-1-amine |
| SMILES | Cn1cc2c(c1N)c1ccccc1n2C |
| InChI | InChI=1S/C12H13N3/c1-14-7-10-11(12(14)13)8-5-3-4-6-9(8)15(10)2/h3-7H,13H2,1-2H3 |
| InChIKey | NQUTZBPBBDHASJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethylpyrrolo[3,4-b]indol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpyrrolo[3,4-b]indol-1-amine?
The IUPAC name of 2,4-dimethylpyrrolo[3,4-b]indol-1-amine (CID 130322165) is 2,4-dimethylpyrrolo[3,4-b]indol-1-amine.
What is the SMILES notation for 2,4-dimethylpyrrolo[3,4-b]indol-1-amine?
The canonical SMILES for 2,4-dimethylpyrrolo[3,4-b]indol-1-amine is Cn1cc2c(c1N)c1ccccc1n2C.
What is the InChIKey of 2,4-dimethylpyrrolo[3,4-b]indol-1-amine?
The InChIKey is NQUTZBPBBDHASJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3/c1-14-7-10-11(12(14)13)8-5-3-4-6-9(8)15(10)2/h3-7H,13H2,1-2H3.
What are the key properties of 2,4-dimethylpyrrolo[3,4-b]indol-1-amine?
2,4-dimethylpyrrolo[3,4-b]indol-1-amine has a molecular weight of 199.26 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpyrrolo[3,4-b]indol-1-amine is sourced from PubChem (CID 130322165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).