C11H9NO2 — CID 130322179
1-methylfuro[2,3-b][1]benzofuran-2-amine (PubChem CID 130322179) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-methylfuro[2,3-b][1]benzofuran-2-amine.
| Compound Name | 1-methylfuro[2,3-b][1]benzofuran-2-amine |
|---|---|
| PubChem CID | 130322179 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1-methylfuro[2,3-b][1]benzofuran-2-amine |
| SMILES | Cc1c(N)oc2oc3ccccc3c12 |
| InChI | InChI=1S/C11H9NO2/c1-6-9-7-4-2-3-5-8(7)13-11(9)14-10(6)12/h2-5H,12H2,1H3 |
| InChIKey | VUHKWVVDLDVDSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |