C23H39NO2 — CID 130327984
2-[(E)-3-(dihexylamino)prop-2-enylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 130327984) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-[(E)-3-(dihexylamino)prop-2-enylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(E)-3-(dihexylamino)prop-2-enylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 130327984 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 2-[(E)-3-(dihexylamino)prop-2-enylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCCCCCN(/C=C/C=C1C(=O)CC(C)(C)CC1=O)CCCCCC |
| InChI | InChI=1S/C23H39NO2/c1-5-7-9-11-15-24(16-12-10-8-6-2)17-13-14-20-21(25)18-23(3,4)19-22(20)26/h13-14,17H,5-12,15-16,18-19H2,1-4H3/b17-13+ |
| InChIKey | FYUWRYUHPPMZIZ-GHRIWEEISA-N |
| XLogP | 5.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|