C15H20N2O3S2 — CID 130328015
ethyl 2-[(5E)-4-oxo-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 130328015) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is ethyl 2-[(5E)-4-oxo-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-4-oxo-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 130328015 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | ethyl 2-[(5E)-4-oxo-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)/C(=C\C=C\N2CCCCC2)SC1=S |
| InChI | InChI=1S/C15H20N2O3S2/c1-2-20-13(18)11-17-14(19)12(22-15(17)21)7-6-10-16-8-4-3-5-9-16/h6-7,10H,2-5,8-9,11H2,1H3/b10-6+,12-7+ |
| InChIKey | MJSHLAOWDHZAPL-QXZILWSFSA-N |
| XLogP | 2.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|