C13H16N2O4S2 — CID 130327970
ethyl 2-[(5E)-5-[(2Z)-2-(3-methyl-1,3-oxazolidin-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 130327970) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[(2Z)-2-(3-methyl-1,3-oxazolidin-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[(2Z)-2-(3-methyl-1,3-oxazolidin-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 130327970 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | ethyl 2-[(5E)-5-[(2Z)-2-(3-methyl-1,3-oxazolidin-2-ylidene)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)/C(=C\C=C2/OCCN2C)SC1=S |
| InChI | InChI=1S/C13H16N2O4S2/c1-3-18-11(16)8-15-12(17)9(21-13(15)20)4-5-10-14(2)6-7-19-10/h4-5H,3,6-8H2,1-2H3/b9-4+,10-5- |
| InChIKey | AHEDMOVOXUMDHC-FTBRZUGYSA-N |
| XLogP | 1.10 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|