C7H10FN3O2 — CID 130330204
4-amino-1-(ethoxymethyl)-5-fluoropyrimidin-2-one (PubChem CID 130330204) has the molecular formula C7H10FN3O2 and a molecular weight of 187.17 g/mol. Its IUPAC name is 4-amino-1-(ethoxymethyl)-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-(ethoxymethyl)-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 130330204 |
| Molecular Formula | C7H10FN3O2 |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-amino-1-(ethoxymethyl)-5-fluoropyrimidin-2-one |
| SMILES | CCOCn1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C7H10FN3O2/c1-2-13-4-11-3-5(8)6(9)10-7(11)12/h3H,2,4H2,1H3,(H2,9,10,12) |
| InChIKey | WBQDNSOEOHJJSM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |