C18H21NO4P+ — CID 130335470
[(3-methyl-1-oxo-1-phenylmethoxybutan-2-yl)amino]-oxo-phenoxyphosphanium (PubChem CID 130335470) has the molecular formula C18H21NO4P+ and a molecular weight of 346.34 g/mol. Its IUPAC name is [(3-methyl-1-oxo-1-phenylmethoxybutan-2-yl)amino]-oxo-phenoxyphosphanium.
| Compound Name | [(3-methyl-1-oxo-1-phenylmethoxybutan-2-yl)amino]-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 130335470 |
| Molecular Formula | C18H21NO4P+ |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(3-methyl-1-oxo-1-phenylmethoxybutan-2-yl)amino]-oxo-phenoxyphosphanium |
| SMILES | CC(C)C(N[P+](=O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO4P/c1-14(2)17(18(20)22-13-15-9-5-3-6-10-15)19-24(21)23-16-11-7-4-8-12-16/h3-12,14,17H,13H2,1-2H3,(H,19,21)/q+1 |
| InChIKey | FJIREBRBJLUYHW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|