C17H22N4O2 — CID 130336942
(1S,2R,4S,5R)-4-[4-[(2,4-dimethoxyphenyl)methyl]-1,2,4-triazol-3-yl]bicyclo[3.1.0]hexan-2-amine (PubChem CID 130336942) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (1S,2R,4S,5R)-4-[4-[(2,4-dimethoxyphenyl)methyl]-1,2,4-triazol-3-yl]bicyclo[3.1.0]hexan-2-amine.
| Compound Name | (1S,2R,4S,5R)-4-[4-[(2,4-dimethoxyphenyl)methyl]-1,2,4-triazol-3-yl]bicyclo[3.1.0]hexan-2-amine |
|---|---|
| PubChem CID | 130336942 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1S,2R,4S,5R)-4-[4-[(2,4-dimethoxyphenyl)methyl]-1,2,4-triazol-3-yl]bicyclo[3.1.0]hexan-2-amine |
| SMILES | COc1ccc(Cn2cnnc2[C@H]2C[C@@H](N)[C@H]3C[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-22-11-4-3-10(16(5-11)23-2)8-21-9-19-20-17(21)14-7-15(18)13-6-12(13)14/h3-5,9,12-15H,6-8,18H2,1-2H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | WQEGULNZDWPVSM-CBBWQLFWSA-N |
| XLogP | 1.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |