C27H33ClN4 — CID 130338001
1-[[2-[3-(4-chloroanilino)prop-1-ynyl]-1-ethylindol-4-yl]methyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 130338001) has the molecular formula C27H33ClN4 and a molecular weight of 449.04 g/mol. Its IUPAC name is 1-[[2-[3-(4-chloroanilino)prop-1-ynyl]-1-ethylindol-4-yl]methyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[[2-[3-(4-chloroanilino)prop-1-ynyl]-1-ethylindol-4-yl]methyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 130338001 |
| Molecular Formula | C27H33ClN4 |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[[2-[3-(4-chloroanilino)prop-1-ynyl]-1-ethylindol-4-yl]methyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | CCn1c(C#CCNc2ccc(Cl)cc2)cc2c(CN3CCC(N(C)C)CC3)cccc21 |
| InChI | InChI=1S/C27H33ClN4/c1-4-32-25(8-6-16-29-23-12-10-22(28)11-13-23)19-26-21(7-5-9-27(26)32)20-31-17-14-24(15-18-31)30(2)3/h5,7,9-13,19,24,29H,4,14-18,20H2,1-3H3 |
| InChIKey | RGSWSPGAMOCDAJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 23.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|