About 1H-pyrrolo[3,2-c]quinoline;toluene
1H-pyrrolo[3,2-c]quinoline;toluene (PubChem CID 130338735) has the molecular formula C18H16N2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 1H-pyrrolo[3,2-c]quinoline;toluene.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,2-c]quinoline;toluene |
| PubChem CID | 130338735 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1H-pyrrolo[3,2-c]quinoline;toluene |
| SMILES | Cc1ccccc1.c1ccc2c(c1)ncc1cc[nH]c12 |
| InChI | InChI=1S/C11H8N2.C7H8/c1-2-4-10-9(3-1)11-8(7-13-10)5-6-12-11;1-7-5-3-2-4-6-7/h1-7,12H;2-6H,1H3 |
| InChIKey | NILOEECENOUWLB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-pyrrolo[3,2-c]quinoline;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,2-c]quinoline;toluene?
The IUPAC name of 1H-pyrrolo[3,2-c]quinoline;toluene (CID 130338735) is 1H-pyrrolo[3,2-c]quinoline;toluene.
What is the SMILES notation for 1H-pyrrolo[3,2-c]quinoline;toluene?
The canonical SMILES for 1H-pyrrolo[3,2-c]quinoline;toluene is Cc1ccccc1.c1ccc2c(c1)ncc1cc[nH]c12.
What is the InChIKey of 1H-pyrrolo[3,2-c]quinoline;toluene?
The InChIKey is NILOEECENOUWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.C7H8/c1-2-4-10-9(3-1)11-8(7-13-10)5-6-12-11;1-7-5-3-2-4-6-7/h1-7,12H;2-6H,1H3.
What are the key properties of 1H-pyrrolo[3,2-c]quinoline;toluene?
1H-pyrrolo[3,2-c]quinoline;toluene has a molecular weight of 260.34 g/mol, XLogP of 4.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,2-c]quinoline;toluene is sourced from PubChem (CID 130338735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).