C26H36F2N2 — CID 130340774
(3E,5E)-N-(1-cycloheptylpropan-2-yl)-5-fluoro-2-(3-fluoro-2,5-dimethylbenzenecarboximidoyl)hepta-1,3,5-trien-4-amine (PubChem CID 130340774) has the molecular formula C26H36F2N2 and a molecular weight of 414.58 g/mol. Its IUPAC name is (3E,5E)-N-(1-cycloheptylpropan-2-yl)-5-fluoro-2-(3-fluoro-2,5-dimethylbenzenecarboximidoyl)hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-N-(1-cycloheptylpropan-2-yl)-5-fluoro-2-(3-fluoro-2,5-dimethylbenzenecarboximidoyl)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 130340774 |
| Molecular Formula | C26H36F2N2 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (3E,5E)-N-(1-cycloheptylpropan-2-yl)-5-fluoro-2-(3-fluoro-2,5-dimethylbenzenecarboximidoyl)hepta-1,3,5-trien-4-amine |
| SMILES | [H]/N=C(/C(=C)/C=C(NC(C)CC1CCCCCC1)/C(F)=C\C)c1cc(C)cc(F)c1C |
| InChI | InChI=1S/C26H36F2N2/c1-6-23(27)25(30-19(4)16-21-11-9-7-8-10-12-21)15-18(3)26(29)22-13-17(2)14-24(28)20(22)5/h6,13-15,19,21,29-30H,3,7-12,16H2,1-2,4-5H3/b23-6-,25-15+,29-26- |
| InChIKey | MMPLTUBDAHHIOR-UPFWAAIMSA-N |
| XLogP | 7.46 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|